C9H12N2O — CID 20676280
3,6-dimethyl-1-prop-2-enylpyrazin-2-one (PubChem CID 20676280) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 3,6-dimethyl-1-prop-2-enylpyrazin-2-one.
| Compound Name | 3,6-dimethyl-1-prop-2-enylpyrazin-2-one |
|---|---|
| PubChem CID | 20676280 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 3,6-dimethyl-1-prop-2-enylpyrazin-2-one |
| SMILES | C=CCn1c(C)cnc(C)c1=O |
| InChI | InChI=1S/C9H12N2O/c1-4-5-11-7(2)6-10-8(3)9(11)12/h4,6H,1,5H2,2-3H3 |
| InChIKey | YBFXIRPJPWGMDS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|