C17H20N4O2 — CID 20676378
N-(diaminomethylidene)-5,7-dimethyl-9-oxo-1-azatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraene-2-carboxamide (PubChem CID 20676378) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-(diaminomethylidene)-5,7-dimethyl-9-oxo-1-azatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraene-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-5,7-dimethyl-9-oxo-1-azatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraene-2-carboxamide |
|---|---|
| PubChem CID | 20676378 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-(diaminomethylidene)-5,7-dimethyl-9-oxo-1-azatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraene-2-carboxamide |
| SMILES | Cc1cc(C)c2cc(C(=O)N=C(N)N)n3c2c1C(=O)CCCC3 |
| InChI | InChI=1S/C17H20N4O2/c1-9-7-10(2)14-13(22)5-3-4-6-21-12(8-11(9)15(14)21)16(23)20-17(18)19/h7-8H,3-6H2,1-2H3,(H4,18,19,20,23) |
| InChIKey | SYWGZBZNUBNDEA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|