C17H22N6OS2 — CID 2067642
[4-amino-6-(2,4-dimethylanilino)-1,3,5-triazin-2-yl]methyl morpholine-4-carbodithioate (PubChem CID 2067642) has the molecular formula C17H22N6OS2 and a molecular weight of 390.54 g/mol. Its IUPAC name is [4-amino-6-(2,4-dimethylanilino)-1,3,5-triazin-2-yl]methyl morpholine-4-carbodithioate.
| Compound Name | [4-amino-6-(2,4-dimethylanilino)-1,3,5-triazin-2-yl]methyl morpholine-4-carbodithioate |
|---|---|
| PubChem CID | 2067642 |
| Molecular Formula | C17H22N6OS2 |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [4-amino-6-(2,4-dimethylanilino)-1,3,5-triazin-2-yl]methyl morpholine-4-carbodithioate |
| SMILES | Cc1ccc(Nc2nc(N)nc(CSC(=S)N3CCOCC3)n2)c(C)c1 |
| InChI | InChI=1S/C17H22N6OS2/c1-11-3-4-13(12(2)9-11)19-16-21-14(20-15(18)22-16)10-26-17(25)23-5-7-24-8-6-23/h3-4,9H,5-8,10H2,1-2H3,(H3,18,19,20,21,22) |
| InChIKey | IIFPDZNLPHTEIO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|