About CID 20676482
CID 20676482 (PubChem CID 20676482) has the molecular formula C13H28O3Si3
and a molecular weight of 316.62 g/mol.
Molecular Properties
| Compound Name | CID 20676482 |
| PubChem CID | 20676482 |
| Molecular Formula | C13H28O3Si3 |
| Molecular Weight | 316.62 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | — |
| SMILES | CO[Si](CCC1CC=CCC1)O[Si](C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H28O3Si3/c1-14-18(15-17(2)16-19(3,4)5)12-11-13-9-7-6-8-10-13/h6-7,13H,8-12H2,1-5H3 |
| InChIKey | GNDQEQPMJSIYOS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.62 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 20676482 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20676482?
The IUPAC name of CID 20676482 (CID 20676482) is not available.
What is the SMILES notation for CID 20676482?
The canonical SMILES for CID 20676482 is CO[Si](CCC1CC=CCC1)O[Si](C)O[Si](C)(C)C.
What is the InChIKey of CID 20676482?
The InChIKey is GNDQEQPMJSIYOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O3Si3/c1-14-18(15-17(2)16-19(3,4)5)12-11-13-9-7-6-8-10-13/h6-7,13H,8-12H2,1-5H3.
What are the key properties of CID 20676482?
CID 20676482 has a molecular weight of 316.62 g/mol, XLogP of 3.85, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20676482 is sourced from PubChem (CID 20676482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).