About 8-(3-methylbuta-1,3-dien-2-yloxy)tricyclo[5.2.1.02,6]decane
8-(3-methylbuta-1,3-dien-2-yloxy)tricyclo[5.2.1.02,6]decane (PubChem CID 20676848) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is 8-(3-methylbuta-1,3-dien-2-yloxy)tricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | 8-(3-methylbuta-1,3-dien-2-yloxy)tricyclo[5.2.1.02,6]decane |
| PubChem CID | 20676848 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 8-(3-methylbuta-1,3-dien-2-yloxy)tricyclo[5.2.1.02,6]decane |
| SMILES | C=C(C)C(=C)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C15H22O/c1-9(2)10(3)16-15-8-11-7-14(15)13-6-4-5-12(11)13/h11-15H,1,3-8H2,2H3 |
| InChIKey | UUEQFVNHXZPGPO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 8-(3-methylbuta-1,3-dien-2-yloxy)tricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3-methylbuta-1,3-dien-2-yloxy)tricyclo[5.2.1.02,6]decane?
The IUPAC name of 8-(3-methylbuta-1,3-dien-2-yloxy)tricyclo[5.2.1.02,6]decane (CID 20676848) is 8-(3-methylbuta-1,3-dien-2-yloxy)tricyclo[5.2.1.02,6]decane.
What is the SMILES notation for 8-(3-methylbuta-1,3-dien-2-yloxy)tricyclo[5.2.1.02,6]decane?
The canonical SMILES for 8-(3-methylbuta-1,3-dien-2-yloxy)tricyclo[5.2.1.02,6]decane is C=C(C)C(=C)OC1CC2CC1C1CCCC21.
What is the InChIKey of 8-(3-methylbuta-1,3-dien-2-yloxy)tricyclo[5.2.1.02,6]decane?
The InChIKey is UUEQFVNHXZPGPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O/c1-9(2)10(3)16-15-8-11-7-14(15)13-6-4-5-12(11)13/h11-15H,1,3-8H2,2H3.
What are the key properties of 8-(3-methylbuta-1,3-dien-2-yloxy)tricyclo[5.2.1.02,6]decane?
8-(3-methylbuta-1,3-dien-2-yloxy)tricyclo[5.2.1.02,6]decane has a molecular weight of 218.34 g/mol, XLogP of 3.92, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3-methylbuta-1,3-dien-2-yloxy)tricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 20676848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).