About 9-buta-1,3-dien-2-yloxytricyclo[6.2.1.02,7]undecane
9-buta-1,3-dien-2-yloxytricyclo[6.2.1.02,7]undecane (PubChem CID 20676854) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is 9-buta-1,3-dien-2-yloxytricyclo[6.2.1.02,7]undecane.
Molecular Properties
| Compound Name | 9-buta-1,3-dien-2-yloxytricyclo[6.2.1.02,7]undecane |
| PubChem CID | 20676854 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 9-buta-1,3-dien-2-yloxytricyclo[6.2.1.02,7]undecane |
| SMILES | C=CC(=C)OC1CC2CC1C1CCCCC21 |
| InChI | InChI=1S/C15H22O/c1-3-10(2)16-15-9-11-8-14(15)13-7-5-4-6-12(11)13/h3,11-15H,1-2,4-9H2 |
| InChIKey | QQQQWMUPKYZCAC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 9-buta-1,3-dien-2-yloxytricyclo[6.2.1.02,7]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-buta-1,3-dien-2-yloxytricyclo[6.2.1.02,7]undecane?
The IUPAC name of 9-buta-1,3-dien-2-yloxytricyclo[6.2.1.02,7]undecane (CID 20676854) is 9-buta-1,3-dien-2-yloxytricyclo[6.2.1.02,7]undecane.
What is the SMILES notation for 9-buta-1,3-dien-2-yloxytricyclo[6.2.1.02,7]undecane?
The canonical SMILES for 9-buta-1,3-dien-2-yloxytricyclo[6.2.1.02,7]undecane is C=CC(=C)OC1CC2CC1C1CCCCC21.
What is the InChIKey of 9-buta-1,3-dien-2-yloxytricyclo[6.2.1.02,7]undecane?
The InChIKey is QQQQWMUPKYZCAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O/c1-3-10(2)16-15-9-11-8-14(15)13-7-5-4-6-12(11)13/h3,11-15H,1-2,4-9H2.
What are the key properties of 9-buta-1,3-dien-2-yloxytricyclo[6.2.1.02,7]undecane?
9-buta-1,3-dien-2-yloxytricyclo[6.2.1.02,7]undecane has a molecular weight of 218.34 g/mol, XLogP of 3.92, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-buta-1,3-dien-2-yloxytricyclo[6.2.1.02,7]undecane is sourced from PubChem (CID 20676854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).