C10H7F13 — CID 20676945
1,1,1,2,2,6,6,7,7,7-decafluoro-4-(1,1,1-trifluoropropan-2-ylidene)heptane (PubChem CID 20676945) has the molecular formula C10H7F13 and a molecular weight of 374.14 g/mol. Its IUPAC name is 1,1,1,2,2,6,6,7,7,7-decafluoro-4-(1,1,1-trifluoropropan-2-ylidene)heptane.
| Compound Name | 1,1,1,2,2,6,6,7,7,7-decafluoro-4-(1,1,1-trifluoropropan-2-ylidene)heptane |
|---|---|
| PubChem CID | 20676945 |
| Molecular Formula | C10H7F13 |
| Molecular Weight | 374.14 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 1,1,1,2,2,6,6,7,7,7-decafluoro-4-(1,1,1-trifluoropropan-2-ylidene)heptane |
| SMILES | CC(=C(CC(F)(F)C(F)(F)F)CC(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H7F13/c1-4(8(15,16)17)5(2-6(11,12)9(18,19)20)3-7(13,14)10(21,22)23/h2-3H2,1H3 |
| InChIKey | DNHCZMZQRCEOLX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.14 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|