C14H21N3O5 — CID 20677112
(2S)-6-amino-2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoic acid (PubChem CID 20677112) has the molecular formula C14H21N3O5 and a molecular weight of 311.34 g/mol. Its IUPAC name is (2S)-6-amino-2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 20677112 |
| Molecular Formula | C14H21N3O5 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (2S)-6-amino-2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)CCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C14H21N3O5/c15-8-2-1-4-10(14(21)22)16-11(18)5-3-9-17-12(19)6-7-13(17)20/h6-7,10H,1-5,8-9,15H2,(H,16,18)(H,21,22)/t10-/m0/s1 |
| InChIKey | BRBHXFPPVYGIMM-JTQLQIEISA-N |
| XLogP | -0.61 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|