C28H35F2N5O6 — CID 20677541
4-(3,4-difluorophenyl)-N-[3-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)propyl]-6-(methoxymethyl)-5-(methylperoxymethyl)-2-oxo-1,4-dihydropyrimidine-3-carboxamide (PubChem CID 20677541) has the molecular formula C28H35F2N5O6 and a molecular weight of 575.61 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-N-[3-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)propyl]-6-(methoxymethyl)-5-(methylperoxymethyl)-2-oxo-1,4-dihydropyrimidine-3-carboxamide.
| Compound Name | 4-(3,4-difluorophenyl)-N-[3-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)propyl]-6-(methoxymethyl)-5-(methylperoxymethyl)-2-oxo-1,4-dihydropyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 20677541 |
| Molecular Formula | C28H35F2N5O6 |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | 4-(3,4-difluorophenyl)-N-[3-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)propyl]-6-(methoxymethyl)-5-(methylperoxymethyl)-2-oxo-1,4-dihydropyrimidine-3-carboxamide |
| SMILES | COCC1=C(COOC)C(c2ccc(F)c(F)c2)N(C(=O)NCCCN2CCC(O)(c3ccccn3)CC2)C(=O)N1 |
| InChI | InChI=1S/C28H35F2N5O6/c1-39-18-23-20(17-41-40-2)25(19-7-8-21(29)22(30)16-19)35(27(37)33-23)26(36)32-12-5-13-34-14-9-28(38,10-15-34)24-6-3-4-11-31-24/h3-4,6-8,11,16,25,38H,5,9-10,12-15,17-18H2,1-2H3,(H,32,36)(H,33,37) |
| InChIKey | VAVNSIFGRLBWPH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 125.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|