About 1-(2-hydroperoxypropan-2-yl)-1,4,4-trimethylcyclohexane
1-(2-hydroperoxypropan-2-yl)-1,4,4-trimethylcyclohexane (PubChem CID 20677704) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is 1-(2-hydroperoxypropan-2-yl)-1,4,4-trimethylcyclohexane.
Molecular Properties
| Compound Name | 1-(2-hydroperoxypropan-2-yl)-1,4,4-trimethylcyclohexane |
| PubChem CID | 20677704 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 1-(2-hydroperoxypropan-2-yl)-1,4,4-trimethylcyclohexane |
| SMILES | CC1(C)CCC(C)(C(C)(C)OO)CC1 |
| InChI | InChI=1S/C12H24O2/c1-10(2)6-8-12(5,9-7-10)11(3,4)14-13/h13H,6-9H2,1-5H3 |
| InChIKey | FUMHETKMSQRZMO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroperoxypropan-2-yl)-1,4,4-trimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroperoxypropan-2-yl)-1,4,4-trimethylcyclohexane?
The IUPAC name of 1-(2-hydroperoxypropan-2-yl)-1,4,4-trimethylcyclohexane (CID 20677704) is 1-(2-hydroperoxypropan-2-yl)-1,4,4-trimethylcyclohexane.
What is the SMILES notation for 1-(2-hydroperoxypropan-2-yl)-1,4,4-trimethylcyclohexane?
The canonical SMILES for 1-(2-hydroperoxypropan-2-yl)-1,4,4-trimethylcyclohexane is CC1(C)CCC(C)(C(C)(C)OO)CC1.
What is the InChIKey of 1-(2-hydroperoxypropan-2-yl)-1,4,4-trimethylcyclohexane?
The InChIKey is FUMHETKMSQRZMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c1-10(2)6-8-12(5,9-7-10)11(3,4)14-13/h13H,6-9H2,1-5H3.
What are the key properties of 1-(2-hydroperoxypropan-2-yl)-1,4,4-trimethylcyclohexane?
1-(2-hydroperoxypropan-2-yl)-1,4,4-trimethylcyclohexane has a molecular weight of 200.32 g/mol, XLogP of 3.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroperoxypropan-2-yl)-1,4,4-trimethylcyclohexane is sourced from PubChem (CID 20677704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).