About actinium;5-azido-6-(benzenesulfinyl)-2-methyloxane-3,4-diol
actinium;5-azido-6-(benzenesulfinyl)-2-methyloxane-3,4-diol (PubChem CID 20677828) has the molecular formula C12H15Ac2N3O4S
and a molecular weight of 751.34 g/mol. Its IUPAC name is actinium;5-azido-6-(benzenesulfinyl)-2-methyloxane-3,4-diol.
Molecular Properties
| Compound Name | actinium;5-azido-6-(benzenesulfinyl)-2-methyloxane-3,4-diol |
| PubChem CID | 20677828 |
| Molecular Formula | C12H15Ac2N3O4S |
| Molecular Weight | 751.34 g/mol |
| Exact Mass | 751.13 |
| IUPAC Name | actinium;5-azido-6-(benzenesulfinyl)-2-methyloxane-3,4-diol |
| SMILES | CC1OC(S(=O)c2ccccc2)C(N=[N+]=[N-])C(O)C1O.[Ac].[Ac] |
| InChI | InChI=1S/C12H15N3O4S.2Ac/c1-7-10(16)11(17)9(14-15-13)12(19-7)20(18)8-5-3-2-4-6-8;;/h2-7,9-12,16-17H,1H3;; |
| InChIKey | GXYXCMLNWGFHOW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 751.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze actinium;5-azido-6-(benzenesulfinyl)-2-methyloxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;5-azido-6-(benzenesulfinyl)-2-methyloxane-3,4-diol?
The IUPAC name of actinium;5-azido-6-(benzenesulfinyl)-2-methyloxane-3,4-diol (CID 20677828) is actinium;5-azido-6-(benzenesulfinyl)-2-methyloxane-3,4-diol.
What is the SMILES notation for actinium;5-azido-6-(benzenesulfinyl)-2-methyloxane-3,4-diol?
The canonical SMILES for actinium;5-azido-6-(benzenesulfinyl)-2-methyloxane-3,4-diol is CC1OC(S(=O)c2ccccc2)C(N=[N+]=[N-])C(O)C1O.[Ac].[Ac].
What is the InChIKey of actinium;5-azido-6-(benzenesulfinyl)-2-methyloxane-3,4-diol?
The InChIKey is GXYXCMLNWGFHOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O4S.2Ac/c1-7-10(16)11(17)9(14-15-13)12(19-7)20(18)8-5-3-2-4-6-8;;/h2-7,9-12,16-17H,1H3;;.
What are the key properties of actinium;5-azido-6-(benzenesulfinyl)-2-methyloxane-3,4-diol?
actinium;5-azido-6-(benzenesulfinyl)-2-methyloxane-3,4-diol has a molecular weight of 751.34 g/mol, XLogP of 0.94, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;5-azido-6-(benzenesulfinyl)-2-methyloxane-3,4-diol is sourced from PubChem (CID 20677828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).