About CID 20678144
CID 20678144 (PubChem CID 20678144) has the molecular formula C20H18GaNO2
and a molecular weight of 374.09 g/mol.
Molecular Properties
| Compound Name | CID 20678144 |
| PubChem CID | 20678144 |
| Molecular Formula | C20H18GaNO2 |
| Molecular Weight | 374.09 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(C(=O)c2ccc(O[Ga])c3ncccc23)cc1 |
| InChI | InChI=1S/C20H19NO2.Ga/c1-20(2,3)14-8-6-13(7-9-14)19(23)16-10-11-17(22)18-15(16)5-4-12-21-18;/h4-12,22H,1-3H3;/q;+1/p-1 |
| InChIKey | BYJOXZNQEONCRR-UHFFFAOYSA-M |
| XLogP | 4.23 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.09 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 20678144 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20678144?
The IUPAC name of CID 20678144 (CID 20678144) is not available.
What is the SMILES notation for CID 20678144?
The canonical SMILES for CID 20678144 is CC(C)(C)c1ccc(C(=O)c2ccc(O[Ga])c3ncccc23)cc1.
What is the InChIKey of CID 20678144?
The InChIKey is BYJOXZNQEONCRR-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H19NO2.Ga/c1-20(2,3)14-8-6-13(7-9-14)19(23)16-10-11-17(22)18-15(16)5-4-12-21-18;/h4-12,22H,1-3H3;/q;+1/p-1.
What are the key properties of CID 20678144?
CID 20678144 has a molecular weight of 374.09 g/mol, XLogP of 4.23, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20678144 is sourced from PubChem (CID 20678144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).