C26H50O10Si — CID 20678176
1-O-(2-hydroxyethyl) 5-O-methyl 3-O-(3-triethoxysilylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 20678176) has the molecular formula C26H50O10Si and a molecular weight of 550.76 g/mol. Its IUPAC name is 1-O-(2-hydroxyethyl) 5-O-methyl 3-O-(3-triethoxysilylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-(2-hydroxyethyl) 5-O-methyl 3-O-(3-triethoxysilylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 20678176 |
| Molecular Formula | C26H50O10Si |
| Molecular Weight | 550.76 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | 1-O-(2-hydroxyethyl) 5-O-methyl 3-O-(3-triethoxysilylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCO[Si](CCCOC(=O)C(C)(CC(C)(C)C(=O)OCCO)CC(C)(CC)C(=O)OC)(OCC)OCC |
| InChI | InChI=1S/C26H50O10Si/c1-10-25(7,22(29)31-9)20-26(8,19-24(5,6)21(28)33-17-15-27)23(30)32-16-14-18-37(34-11-2,35-12-3)36-13-4/h27H,10-20H2,1-9H3 |
| InChIKey | GYVFKXHZVRKMHG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.76 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|