C9H13NO — CID 20678655
1-(1,2,3,3a,4,6a-hexahydrocyclopenta[b]pyrrol-2-yl)ethanone (PubChem CID 20678655) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-(1,2,3,3a,4,6a-hexahydrocyclopenta[b]pyrrol-2-yl)ethanone.
| Compound Name | 1-(1,2,3,3a,4,6a-hexahydrocyclopenta[b]pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 20678655 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 1-(1,2,3,3a,4,6a-hexahydrocyclopenta[b]pyrrol-2-yl)ethanone |
| SMILES | CC(=O)C1CC2CC=CC2N1 |
| InChI | InChI=1S/C9H13NO/c1-6(11)9-5-7-3-2-4-8(7)10-9/h2,4,7-10H,3,5H2,1H3 |
| InChIKey | SUMQZUSEPUSVOL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|