About 1-spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-ylethanone
1-spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-ylethanone (PubChem CID 20678663) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-ylethanone.
Molecular Properties
| Compound Name | 1-spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-ylethanone |
| PubChem CID | 20678663 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-ylethanone |
| SMILES | CC(=O)C1CC2(CN1)CC1CCC2C1 |
| InChI | InChI=1S/C12H19NO/c1-8(14)11-6-12(7-13-11)5-9-2-3-10(12)4-9/h9-11,13H,2-7H2,1H3 |
| InChIKey | XIDGOQIOWVKLBJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-ylethanone?
The IUPAC name of 1-spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-ylethanone (CID 20678663) is 1-spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-ylethanone.
What is the SMILES notation for 1-spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-ylethanone?
The canonical SMILES for 1-spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-ylethanone is CC(=O)C1CC2(CN1)CC1CCC2C1.
What is the InChIKey of 1-spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-ylethanone?
The InChIKey is XIDGOQIOWVKLBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-8(14)11-6-12(7-13-11)5-9-2-3-10(12)4-9/h9-11,13H,2-7H2,1H3.
What are the key properties of 1-spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-ylethanone?
1-spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-ylethanone has a molecular weight of 193.29 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-ylethanone is sourced from PubChem (CID 20678663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).