About 2-ethylpteridine
2-ethylpteridine (PubChem CID 20678679) has the molecular formula C8H8N4
and a molecular weight of 160.18 g/mol. Its IUPAC name is 2-ethylpteridine.
Molecular Properties
| Compound Name | 2-ethylpteridine |
| PubChem CID | 20678679 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2-ethylpteridine |
| SMILES | CCc1ncc2nccnc2n1 |
| InChI | InChI=1S/C8H8N4/c1-2-7-11-5-6-8(12-7)10-4-3-9-6/h3-5H,2H2,1H3 |
| InChIKey | MERSEJRRBHRIHT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethylpteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylpteridine?
The IUPAC name of 2-ethylpteridine (CID 20678679) is 2-ethylpteridine.
What is the SMILES notation for 2-ethylpteridine?
The canonical SMILES for 2-ethylpteridine is CCc1ncc2nccnc2n1.
What is the InChIKey of 2-ethylpteridine?
The InChIKey is MERSEJRRBHRIHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4/c1-2-7-11-5-6-8(12-7)10-4-3-9-6/h3-5H,2H2,1H3.
What are the key properties of 2-ethylpteridine?
2-ethylpteridine has a molecular weight of 160.18 g/mol, XLogP of 0.98, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylpteridine is sourced from PubChem (CID 20678679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).