About 6-chloro-2,3-dimethylthieno[2,3-d]pyrimidin-4-one
6-chloro-2,3-dimethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 20678895) has the molecular formula C8H7ClN2OS
and a molecular weight of 214.68 g/mol. Its IUPAC name is 6-chloro-2,3-dimethylthieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-chloro-2,3-dimethylthieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 20678895 |
| Molecular Formula | C8H7ClN2OS |
| Molecular Weight | 214.68 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 6-chloro-2,3-dimethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2sc(Cl)cc2c(=O)n1C |
| InChI | InChI=1S/C8H7ClN2OS/c1-4-10-7-5(3-6(9)13-7)8(12)11(4)2/h3H,1-2H3 |
| InChIKey | SWBYXFNOQPIYFO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.68 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-2,3-dimethylthieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,3-dimethylthieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 6-chloro-2,3-dimethylthieno[2,3-d]pyrimidin-4-one (CID 20678895) is 6-chloro-2,3-dimethylthieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 6-chloro-2,3-dimethylthieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 6-chloro-2,3-dimethylthieno[2,3-d]pyrimidin-4-one is Cc1nc2sc(Cl)cc2c(=O)n1C.
What is the InChIKey of 6-chloro-2,3-dimethylthieno[2,3-d]pyrimidin-4-one?
The InChIKey is SWBYXFNOQPIYFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2OS/c1-4-10-7-5(3-6(9)13-7)8(12)11(4)2/h3H,1-2H3.
What are the key properties of 6-chloro-2,3-dimethylthieno[2,3-d]pyrimidin-4-one?
6-chloro-2,3-dimethylthieno[2,3-d]pyrimidin-4-one has a molecular weight of 214.68 g/mol, XLogP of 1.96, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,3-dimethylthieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 20678895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).