C10H10O2 — CID 20679317
11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene (PubChem CID 20679317) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is 11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene.
| Compound Name | 11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene |
|---|---|
| PubChem CID | 20679317 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene |
| SMILES | C1=CC2OC1C1=C2C2CCC1O2 |
| InChI | InChI=1S/C10H10O2/c1-2-6-10-8-4-3-7(12-8)9(10)5(1)11-6/h1-2,5-8H,3-4H2 |
| InChIKey | DTDNLTLKAJBVGZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|