C16H16O2 — CID 20679326
3,6-dimethoxytetracyclo[6.4.2.02,7.09,12]tetradeca-2,4,6,10,13-pentaene (PubChem CID 20679326) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 3,6-dimethoxytetracyclo[6.4.2.02,7.09,12]tetradeca-2,4,6,10,13-pentaene.
| Compound Name | 3,6-dimethoxytetracyclo[6.4.2.02,7.09,12]tetradeca-2,4,6,10,13-pentaene |
|---|---|
| PubChem CID | 20679326 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 3,6-dimethoxytetracyclo[6.4.2.02,7.09,12]tetradeca-2,4,6,10,13-pentaene |
| SMILES | COc1ccc(OC)c2c1C1C=CC2C2C=CC12 |
| InChI | InChI=1S/C16H16O2/c1-17-13-7-8-14(18-2)16-12-6-5-11(15(13)16)9-3-4-10(9)12/h3-12H,1-2H3 |
| InChIKey | FUSGIAVRWSPRGL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|