About (2,5-dioxopyrrolidin-1-yl) 4-oxopentanoate
(2,5-dioxopyrrolidin-1-yl) 4-oxopentanoate (PubChem CID 20679361) has the molecular formula C9H11NO5
and a molecular weight of 213.19 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-oxopentanoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-oxopentanoate |
| PubChem CID | 20679361 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H11NO5/c1-6(11)2-5-9(14)15-10-7(12)3-4-8(10)13/h2-5H2,1H3 |
| InChIKey | RYTNUBMUCRZNKN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 4-oxopentanoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 4-oxopentanoate (CID 20679361) is (2,5-dioxopyrrolidin-1-yl) 4-oxopentanoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 4-oxopentanoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 4-oxopentanoate is CC(=O)CCC(=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 4-oxopentanoate?
The InChIKey is RYTNUBMUCRZNKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO5/c1-6(11)2-5-9(14)15-10-7(12)3-4-8(10)13/h2-5H2,1H3.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 4-oxopentanoate?
(2,5-dioxopyrrolidin-1-yl) 4-oxopentanoate has a molecular weight of 213.19 g/mol, XLogP of -0.04, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 4-oxopentanoate is sourced from PubChem (CID 20679361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).