C10H18AcO5S — CID 20679571
actinium;methyl 2-[6-[hydroxy(sulfanyl)methyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 20679571) has the molecular formula C10H18AcO5S and a molecular weight of 477.32 g/mol. Its IUPAC name is actinium;methyl 2-[6-[hydroxy(sulfanyl)methyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | actinium;methyl 2-[6-[hydroxy(sulfanyl)methyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 20679571 |
| Molecular Formula | C10H18AcO5S |
| Molecular Weight | 477.32 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | actinium;methyl 2-[6-[hydroxy(sulfanyl)methyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | COC(=O)CC1CC(C(O)S)OC(C)(C)O1.[Ac] |
| InChI | InChI=1S/C10H18O5S.Ac/c1-10(2)14-6(5-8(11)13-3)4-7(15-10)9(12)16;/h6-7,9,12,16H,4-5H2,1-3H3; |
| InChIKey | GXMREISXWRDPJZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|