C10H18O5S — CID 20679572
methyl 2-[6-[hydroxy(sulfanyl)methyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 20679572) has the molecular formula C10H18O5S and a molecular weight of 250.32 g/mol. Its IUPAC name is methyl 2-[6-[hydroxy(sulfanyl)methyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | methyl 2-[6-[hydroxy(sulfanyl)methyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 20679572 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | methyl 2-[6-[hydroxy(sulfanyl)methyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | COC(=O)CC1CC(C(O)S)OC(C)(C)O1 |
| InChI | InChI=1S/C10H18O5S/c1-10(2)14-6(5-8(11)13-3)4-7(15-10)9(12)16/h6-7,9,12,16H,4-5H2,1-3H3 |
| InChIKey | NEOGCFFQLKPWIH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|