C22H37Cl3Si3 — CID 20679584
trimethyl-[3-[6-trichlorosilyl-2-(3-trimethylsilylcyclopenta-1,4-dien-1-yl)hexan-2-yl]cyclopenta-2,4-dien-1-yl]silane (PubChem CID 20679584) has the molecular formula C22H37Cl3Si3 and a molecular weight of 492.16 g/mol. Its IUPAC name is trimethyl-[3-[6-trichlorosilyl-2-(3-trimethylsilylcyclopenta-1,4-dien-1-yl)hexan-2-yl]cyclopenta-2,4-dien-1-yl]silane.
| Compound Name | trimethyl-[3-[6-trichlorosilyl-2-(3-trimethylsilylcyclopenta-1,4-dien-1-yl)hexan-2-yl]cyclopenta-2,4-dien-1-yl]silane |
|---|---|
| PubChem CID | 20679584 |
| Molecular Formula | C22H37Cl3Si3 |
| Molecular Weight | 492.16 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | trimethyl-[3-[6-trichlorosilyl-2-(3-trimethylsilylcyclopenta-1,4-dien-1-yl)hexan-2-yl]cyclopenta-2,4-dien-1-yl]silane |
| SMILES | CC(CCCC[Si](Cl)(Cl)Cl)(C1=CC([Si](C)(C)C)C=C1)C1=CC([Si](C)(C)C)C=C1 |
| InChI | InChI=1S/C22H37Cl3Si3/c1-22(14-8-9-15-28(23,24)25,18-10-12-20(16-18)26(2,3)4)19-11-13-21(17-19)27(5,6)7/h10-13,16-17,20-21H,8-9,14-15H2,1-7H3 |
| InChIKey | LAGPRAFROOJLLD-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.16 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|