C22H36Si2 — CID 20679586
trimethyl-[3-[2-(3-trimethylsilylcyclopenta-1,4-dien-1-yl)hex-5-en-2-yl]cyclopenta-2,4-dien-1-yl]silane (PubChem CID 20679586) has the molecular formula C22H36Si2 and a molecular weight of 356.70 g/mol. Its IUPAC name is trimethyl-[3-[2-(3-trimethylsilylcyclopenta-1,4-dien-1-yl)hex-5-en-2-yl]cyclopenta-2,4-dien-1-yl]silane.
| Compound Name | trimethyl-[3-[2-(3-trimethylsilylcyclopenta-1,4-dien-1-yl)hex-5-en-2-yl]cyclopenta-2,4-dien-1-yl]silane |
|---|---|
| PubChem CID | 20679586 |
| Molecular Formula | C22H36Si2 |
| Molecular Weight | 356.70 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | trimethyl-[3-[2-(3-trimethylsilylcyclopenta-1,4-dien-1-yl)hex-5-en-2-yl]cyclopenta-2,4-dien-1-yl]silane |
| SMILES | C=CCCC(C)(C1=CC([Si](C)(C)C)C=C1)C1=CC([Si](C)(C)C)C=C1 |
| InChI | InChI=1S/C22H36Si2/c1-9-10-15-22(2,18-11-13-20(16-18)23(3,4)5)19-12-14-21(17-19)24(6,7)8/h9,11-14,16-17,20-21H,1,10,15H2,2-8H3 |
| InChIKey | FXLRTUQOUKGRKU-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.70 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|