About 6-benzylsulfanyl-5-(2-hydroxyethylamino)-2H-1,2,4-triazin-3-one
6-benzylsulfanyl-5-(2-hydroxyethylamino)-2H-1,2,4-triazin-3-one (PubChem CID 2067986) has the molecular formula C12H14N4O2S
and a molecular weight of 278.34 g/mol. Its IUPAC name is 6-benzylsulfanyl-5-(2-hydroxyethylamino)-2H-1,2,4-triazin-3-one.
Molecular Properties
| Compound Name | 6-benzylsulfanyl-5-(2-hydroxyethylamino)-2H-1,2,4-triazin-3-one |
| PubChem CID | 2067986 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 6-benzylsulfanyl-5-(2-hydroxyethylamino)-2H-1,2,4-triazin-3-one |
| SMILES | O=c1nc(NCCO)c(SCc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C12H14N4O2S/c17-7-6-13-10-11(15-16-12(18)14-10)19-8-9-4-2-1-3-5-9/h1-5,17H,6-8H2,(H2,13,14,16,18) |
| InChIKey | SUDZXTVFQJBSDX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-benzylsulfanyl-5-(2-hydroxyethylamino)-2H-1,2,4-triazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzylsulfanyl-5-(2-hydroxyethylamino)-2H-1,2,4-triazin-3-one?
The IUPAC name of 6-benzylsulfanyl-5-(2-hydroxyethylamino)-2H-1,2,4-triazin-3-one (CID 2067986) is 6-benzylsulfanyl-5-(2-hydroxyethylamino)-2H-1,2,4-triazin-3-one.
What is the SMILES notation for 6-benzylsulfanyl-5-(2-hydroxyethylamino)-2H-1,2,4-triazin-3-one?
The canonical SMILES for 6-benzylsulfanyl-5-(2-hydroxyethylamino)-2H-1,2,4-triazin-3-one is O=c1nc(NCCO)c(SCc2ccccc2)n[nH]1.
What is the InChIKey of 6-benzylsulfanyl-5-(2-hydroxyethylamino)-2H-1,2,4-triazin-3-one?
The InChIKey is SUDZXTVFQJBSDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2S/c17-7-6-13-10-11(15-16-12(18)14-10)19-8-9-4-2-1-3-5-9/h1-5,17H,6-8H2,(H2,13,14,16,18).
What are the key properties of 6-benzylsulfanyl-5-(2-hydroxyethylamino)-2H-1,2,4-triazin-3-one?
6-benzylsulfanyl-5-(2-hydroxyethylamino)-2H-1,2,4-triazin-3-one has a molecular weight of 278.34 g/mol, XLogP of 0.86, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzylsulfanyl-5-(2-hydroxyethylamino)-2H-1,2,4-triazin-3-one is sourced from PubChem (CID 2067986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).