C25H38Cl2O7 — CID 20679918
2,3-dichloro-2,5,5-trimethyl-3-(oxan-2-yloxycarbonyl)-6-oxo-6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]hexanoic acid (PubChem CID 20679918) has the molecular formula C25H38Cl2O7 and a molecular weight of 521.48 g/mol. Its IUPAC name is 2,3-dichloro-2,5,5-trimethyl-3-(oxan-2-yloxycarbonyl)-6-oxo-6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]hexanoic acid.
| Compound Name | 2,3-dichloro-2,5,5-trimethyl-3-(oxan-2-yloxycarbonyl)-6-oxo-6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]hexanoic acid |
|---|---|
| PubChem CID | 20679918 |
| Molecular Formula | C25H38Cl2O7 |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 2,3-dichloro-2,5,5-trimethyl-3-(oxan-2-yloxycarbonyl)-6-oxo-6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]hexanoic acid |
| SMILES | CC(C)(CC(Cl)(C(=O)OC1CCCCO1)C(C)(Cl)C(=O)O)C(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C25H38Cl2O7/c1-21(2,19(30)33-16-13-15-10-11-23(16,5)22(15,3)4)14-25(27,24(6,26)18(28)29)20(31)34-17-9-7-8-12-32-17/h15-17H,7-14H2,1-6H3,(H,28,29) |
| InChIKey | HFTPOSAUTSHIGT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|