C29H40Cl4O10 — CID 20679920
2,3-dichloro-5-(3,4-dichloro-4-methyl-2,5-dioxooxolan-3-yl)-2,5-dimethyl-3-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonyl-6-(oxan-2-yloxy)-6-oxohexanoic acid (PubChem CID 20679920) has the molecular formula C29H40Cl4O10 and a molecular weight of 690.44 g/mol. Its IUPAC name is 2,3-dichloro-5-(3,4-dichloro-4-methyl-2,5-dioxooxolan-3-yl)-2,5-dimethyl-3-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonyl-6-(oxan-2-yloxy)-6-oxohexanoic acid.
| Compound Name | 2,3-dichloro-5-(3,4-dichloro-4-methyl-2,5-dioxooxolan-3-yl)-2,5-dimethyl-3-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonyl-6-(oxan-2-yloxy)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 20679920 |
| Molecular Formula | C29H40Cl4O10 |
| Molecular Weight | 690.44 g/mol |
| Exact Mass | 688.14 |
| IUPAC Name | 2,3-dichloro-5-(3,4-dichloro-4-methyl-2,5-dioxooxolan-3-yl)-2,5-dimethyl-3-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonyl-6-(oxan-2-yloxy)-6-oxohexanoic acid |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C(Cl)(CC(C)(C(=O)OC2CCCCO2)C2(Cl)C(=O)OC(=O)C2(C)Cl)C(C)(Cl)C(=O)O)C1 |
| InChI | InChI=1S/C29H40Cl4O10/c1-15(2)17-11-10-16(3)13-18(17)41-23(38)28(32,26(5,30)20(34)35)14-25(4,21(36)42-19-9-7-8-12-40-19)29(33)24(39)43-22(37)27(29,6)31/h15-19H,7-14H2,1-6H3,(H,34,35) |
| InChIKey | PUCTVRBPEDIJOC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|