About 2-ethyl-2,4,4-trimethyl-5-(1-methylcycloheptyl)oxy-5-oxopentanoic acid
2-ethyl-2,4,4-trimethyl-5-(1-methylcycloheptyl)oxy-5-oxopentanoic acid (PubChem CID 20679931) has the molecular formula C18H32O4
and a molecular weight of 312.45 g/mol. Its IUPAC name is 2-ethyl-2,4,4-trimethyl-5-(1-methylcycloheptyl)oxy-5-oxopentanoic acid.
Molecular Properties
| Compound Name | 2-ethyl-2,4,4-trimethyl-5-(1-methylcycloheptyl)oxy-5-oxopentanoic acid |
| PubChem CID | 20679931 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 2-ethyl-2,4,4-trimethyl-5-(1-methylcycloheptyl)oxy-5-oxopentanoic acid |
| SMILES | CCC(C)(CC(C)(C)C(=O)OC1(C)CCCCCC1)C(=O)O |
| InChI | InChI=1S/C18H32O4/c1-6-17(4,14(19)20)13-16(2,3)15(21)22-18(5)11-9-7-8-10-12-18/h6-13H2,1-5H3,(H,19,20) |
| InChIKey | SUIOFMLSQVLZOC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-2,4,4-trimethyl-5-(1-methylcycloheptyl)oxy-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,4,4-trimethyl-5-(1-methylcycloheptyl)oxy-5-oxopentanoic acid?
The IUPAC name of 2-ethyl-2,4,4-trimethyl-5-(1-methylcycloheptyl)oxy-5-oxopentanoic acid (CID 20679931) is 2-ethyl-2,4,4-trimethyl-5-(1-methylcycloheptyl)oxy-5-oxopentanoic acid.
What is the SMILES notation for 2-ethyl-2,4,4-trimethyl-5-(1-methylcycloheptyl)oxy-5-oxopentanoic acid?
The canonical SMILES for 2-ethyl-2,4,4-trimethyl-5-(1-methylcycloheptyl)oxy-5-oxopentanoic acid is CCC(C)(CC(C)(C)C(=O)OC1(C)CCCCCC1)C(=O)O.
What is the InChIKey of 2-ethyl-2,4,4-trimethyl-5-(1-methylcycloheptyl)oxy-5-oxopentanoic acid?
The InChIKey is SUIOFMLSQVLZOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O4/c1-6-17(4,14(19)20)13-16(2,3)15(21)22-18(5)11-9-7-8-10-12-18/h6-13H2,1-5H3,(H,19,20).
What are the key properties of 2-ethyl-2,4,4-trimethyl-5-(1-methylcycloheptyl)oxy-5-oxopentanoic acid?
2-ethyl-2,4,4-trimethyl-5-(1-methylcycloheptyl)oxy-5-oxopentanoic acid has a molecular weight of 312.45 g/mol, XLogP of 4.56, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,4,4-trimethyl-5-(1-methylcycloheptyl)oxy-5-oxopentanoic acid is sourced from PubChem (CID 20679931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).