C22H38O4 — CID 20679935
2-ethyl-2,4,4-trimethyl-5-oxo-5-[(1,2,4,7,7-pentamethyl-2-bicyclo[2.2.1]heptanyl)oxy]pentanoic acid (PubChem CID 20679935) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is 2-ethyl-2,4,4-trimethyl-5-oxo-5-[(1,2,4,7,7-pentamethyl-2-bicyclo[2.2.1]heptanyl)oxy]pentanoic acid.
| Compound Name | 2-ethyl-2,4,4-trimethyl-5-oxo-5-[(1,2,4,7,7-pentamethyl-2-bicyclo[2.2.1]heptanyl)oxy]pentanoic acid |
|---|---|
| PubChem CID | 20679935 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 2-ethyl-2,4,4-trimethyl-5-oxo-5-[(1,2,4,7,7-pentamethyl-2-bicyclo[2.2.1]heptanyl)oxy]pentanoic acid |
| SMILES | CCC(C)(CC(C)(C)C(=O)OC1(C)CC2(C)CCC1(C)C2(C)C)C(=O)O |
| InChI | InChI=1S/C22H38O4/c1-10-19(6,15(23)24)13-17(2,3)16(25)26-22(9)14-20(7)11-12-21(22,8)18(20,4)5/h10-14H2,1-9H3,(H,23,24) |
| InChIKey | YWJVKCGVVLXYAG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |