C24H42O4 — CID 20679942
2-ethyl-2,7-dimethyl-8-oxo-8-[(1,2,4,7,7-pentamethyl-2-bicyclo[2.2.1]heptanyl)oxy]octanoic acid (PubChem CID 20679942) has the molecular formula C24H42O4 and a molecular weight of 394.60 g/mol. Its IUPAC name is 2-ethyl-2,7-dimethyl-8-oxo-8-[(1,2,4,7,7-pentamethyl-2-bicyclo[2.2.1]heptanyl)oxy]octanoic acid.
| Compound Name | 2-ethyl-2,7-dimethyl-8-oxo-8-[(1,2,4,7,7-pentamethyl-2-bicyclo[2.2.1]heptanyl)oxy]octanoic acid |
|---|---|
| PubChem CID | 20679942 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | 2-ethyl-2,7-dimethyl-8-oxo-8-[(1,2,4,7,7-pentamethyl-2-bicyclo[2.2.1]heptanyl)oxy]octanoic acid |
| SMILES | CCC(C)(CCCCC(C)C(=O)OC1(C)CC2(C)CCC1(C)C2(C)C)C(=O)O |
| InChI | InChI=1S/C24H42O4/c1-9-21(5,19(26)27)13-11-10-12-17(2)18(25)28-24(8)16-22(6)14-15-23(24,7)20(22,3)4/h17H,9-16H2,1-8H3,(H,26,27) |
| InChIKey | UNUZNWOTHUJXJX-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|