C28H48O5 — CID 20679958
4-(2,2-dimethylpropanoyl)-2,2,4,6-tetramethyl-6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]octanoic acid (PubChem CID 20679958) has the molecular formula C28H48O5 and a molecular weight of 464.69 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyl)-2,2,4,6-tetramethyl-6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]octanoic acid.
| Compound Name | 4-(2,2-dimethylpropanoyl)-2,2,4,6-tetramethyl-6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]octanoic acid |
|---|---|
| PubChem CID | 20679958 |
| Molecular Formula | C28H48O5 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | 4-(2,2-dimethylpropanoyl)-2,2,4,6-tetramethyl-6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]octanoic acid |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)O)C(=O)C(C)(C)C)C(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C28H48O5/c1-12-26(9,22(32)33-19-15-18-13-14-28(19,11)25(18,7)8)17-27(10,20(29)23(2,3)4)16-24(5,6)21(30)31/h18-19H,12-17H2,1-11H3,(H,30,31) |
| InChIKey | WHHXPXJYSAQPQZ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |