About carbanide;N-methanidyl-N,N'-dimethylethanimidamide;tungsten
carbanide;N-methanidyl-N,N'-dimethylethanimidamide;tungsten (PubChem CID 20680345) has the molecular formula C7H17N2W-3
and a molecular weight of 313.07 g/mol. Its IUPAC name is carbanide;N-methanidyl-N,N'-dimethylethanimidamide;tungsten.
Molecular Properties
| Compound Name | carbanide;N-methanidyl-N,N'-dimethylethanimidamide;tungsten |
| PubChem CID | 20680345 |
| Molecular Formula | C7H17N2W-3 |
| Molecular Weight | 313.07 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | carbanide;N-methanidyl-N,N'-dimethylethanimidamide;tungsten |
| SMILES | [CH2-]N(C)/C(C)=N/C.[CH3-].[CH3-].[W] |
| InChI | InChI=1S/C5H11N2.2CH3.W/c1-5(6-2)7(3)4;;;/h3H2,1-2,4H3;2*1H3;/q3*-1;/b6-5+;;; |
| InChIKey | KOZCWKWJJYPPCF-FWMLTEASSA-N |
| XLogP | 1.66 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.07 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze carbanide;N-methanidyl-N,N'-dimethylethanimidamide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;N-methanidyl-N,N'-dimethylethanimidamide;tungsten?
The IUPAC name of carbanide;N-methanidyl-N,N'-dimethylethanimidamide;tungsten (CID 20680345) is carbanide;N-methanidyl-N,N'-dimethylethanimidamide;tungsten.
What is the SMILES notation for carbanide;N-methanidyl-N,N'-dimethylethanimidamide;tungsten?
The canonical SMILES for carbanide;N-methanidyl-N,N'-dimethylethanimidamide;tungsten is [CH2-]N(C)/C(C)=N/C.[CH3-].[CH3-].[W].
What is the InChIKey of carbanide;N-methanidyl-N,N'-dimethylethanimidamide;tungsten?
The InChIKey is KOZCWKWJJYPPCF-FWMLTEASSA-N. The full InChI is InChI=1S/C5H11N2.2CH3.W/c1-5(6-2)7(3)4;;;/h3H2,1-2,4H3;2*1H3;/q3*-1;/b6-5+;;;.
What are the key properties of carbanide;N-methanidyl-N,N'-dimethylethanimidamide;tungsten?
carbanide;N-methanidyl-N,N'-dimethylethanimidamide;tungsten has a molecular weight of 313.07 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;N-methanidyl-N,N'-dimethylethanimidamide;tungsten is sourced from PubChem (CID 20680345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).