C26H27N3O3 — CID 20680479
4-[4-[2-(N-benzylanilino)-2-oxoethyl]piperazin-1-yl]benzoic acid (PubChem CID 20680479) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is 4-[4-[2-(N-benzylanilino)-2-oxoethyl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[2-(N-benzylanilino)-2-oxoethyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 20680479 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 4-[4-[2-(N-benzylanilino)-2-oxoethyl]piperazin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCN(CC(=O)N(Cc3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H27N3O3/c30-25(29(24-9-5-2-6-10-24)19-21-7-3-1-4-8-21)20-27-15-17-28(18-16-27)23-13-11-22(12-14-23)26(31)32/h1-14H,15-20H2,(H,31,32) |
| InChIKey | WKNDGVNFAPQGNJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |