C17H17F3N4O4 — CID 20680570
(3R)-1-[(4-aminoquinolin-7-yl)methyl]-2-oxopyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 20680570) has the molecular formula C17H17F3N4O4 and a molecular weight of 398.34 g/mol. Its IUPAC name is (3R)-1-[(4-aminoquinolin-7-yl)methyl]-2-oxopyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3R)-1-[(4-aminoquinolin-7-yl)methyl]-2-oxopyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 20680570 |
| Molecular Formula | C17H17F3N4O4 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (3R)-1-[(4-aminoquinolin-7-yl)methyl]-2-oxopyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)[C@H]1CCN(Cc2ccc3c(N)ccnc3c2)C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H16N4O2.C2HF3O2/c16-12-3-5-18-13-7-9(1-2-10(12)13)8-19-6-4-11(14(17)20)15(19)21;3-2(4,5)1(6)7/h1-3,5,7,11H,4,6,8H2,(H2,16,18)(H2,17,20);(H,6,7)/t11-;/m1./s1 |
| InChIKey | VWEGVRGLCNIYIT-RFVHGSKJSA-N |
| XLogP | 1.28 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|