C17H21NO3S2 — CID 20680838
N-[(5-tert-butylsulfonylthiophen-2-yl)methyl]-4-methylbenzamide (PubChem CID 20680838) has the molecular formula C17H21NO3S2 and a molecular weight of 351.49 g/mol. Its IUPAC name is N-[(5-tert-butylsulfonylthiophen-2-yl)methyl]-4-methylbenzamide.
| Compound Name | N-[(5-tert-butylsulfonylthiophen-2-yl)methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 20680838 |
| Molecular Formula | C17H21NO3S2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[(5-tert-butylsulfonylthiophen-2-yl)methyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2ccc(S(=O)(=O)C(C)(C)C)s2)cc1 |
| InChI | InChI=1S/C17H21NO3S2/c1-12-5-7-13(8-6-12)16(19)18-11-14-9-10-15(22-14)23(20,21)17(2,3)4/h5-10H,11H2,1-4H3,(H,18,19) |
| InChIKey | AQVWCDJGXJOMGF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |