C21H34N2 — CID 20681062
1-(4,4,5,5-tetramethyl-3H-pyrrol-2-yl)-N-[2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)propan-2-yl]ethanimine (PubChem CID 20681062) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is 1-(4,4,5,5-tetramethyl-3H-pyrrol-2-yl)-N-[2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)propan-2-yl]ethanimine.
| Compound Name | 1-(4,4,5,5-tetramethyl-3H-pyrrol-2-yl)-N-[2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)propan-2-yl]ethanimine |
|---|---|
| PubChem CID | 20681062 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | 1-(4,4,5,5-tetramethyl-3H-pyrrol-2-yl)-N-[2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)propan-2-yl]ethanimine |
| SMILES | CC1=C(C)C(C)=C(C(C)(C)/N=C(\C)C2=NC(C)(C)C(C)(C)C2)C1 |
| InChI | InChI=1S/C21H34N2/c1-13-11-17(15(3)14(13)2)20(7,8)22-16(4)18-12-19(5,6)21(9,10)23-18/h11-12H2,1-10H3/b22-16+ |
| InChIKey | FFDYGDJQRLSEER-CJLVFECKSA-N |
| XLogP | 5.93 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|