About (6,8-dimethylnaphthalen-2-yl)-(2,4-dimethylphenyl)diazene
(6,8-dimethylnaphthalen-2-yl)-(2,4-dimethylphenyl)diazene (PubChem CID 20681158) has the molecular formula C20H20N2
and a molecular weight of 288.39 g/mol. Its IUPAC name is (6,8-dimethylnaphthalen-2-yl)-(2,4-dimethylphenyl)diazene.
Molecular Properties
| Compound Name | (6,8-dimethylnaphthalen-2-yl)-(2,4-dimethylphenyl)diazene |
| PubChem CID | 20681158 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (6,8-dimethylnaphthalen-2-yl)-(2,4-dimethylphenyl)diazene |
| SMILES | Cc1ccc(/N=N/c2ccc3cc(C)cc(C)c3c2)c(C)c1 |
| InChI | InChI=1S/C20H20N2/c1-13-5-8-20(16(4)9-13)22-21-18-7-6-17-11-14(2)10-15(3)19(17)12-18/h5-12H,1-4H3/b22-21+ |
| InChIKey | OXKAIDBVICNWIF-QURGRASLSA-N |
| XLogP | 6.49 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (6,8-dimethylnaphthalen-2-yl)-(2,4-dimethylphenyl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6,8-dimethylnaphthalen-2-yl)-(2,4-dimethylphenyl)diazene?
The IUPAC name of (6,8-dimethylnaphthalen-2-yl)-(2,4-dimethylphenyl)diazene (CID 20681158) is (6,8-dimethylnaphthalen-2-yl)-(2,4-dimethylphenyl)diazene.
What is the SMILES notation for (6,8-dimethylnaphthalen-2-yl)-(2,4-dimethylphenyl)diazene?
The canonical SMILES for (6,8-dimethylnaphthalen-2-yl)-(2,4-dimethylphenyl)diazene is Cc1ccc(/N=N/c2ccc3cc(C)cc(C)c3c2)c(C)c1.
What is the InChIKey of (6,8-dimethylnaphthalen-2-yl)-(2,4-dimethylphenyl)diazene?
The InChIKey is OXKAIDBVICNWIF-QURGRASLSA-N. The full InChI is InChI=1S/C20H20N2/c1-13-5-8-20(16(4)9-13)22-21-18-7-6-17-11-14(2)10-15(3)19(17)12-18/h5-12H,1-4H3/b22-21+.
What are the key properties of (6,8-dimethylnaphthalen-2-yl)-(2,4-dimethylphenyl)diazene?
(6,8-dimethylnaphthalen-2-yl)-(2,4-dimethylphenyl)diazene has a molecular weight of 288.39 g/mol, XLogP of 6.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6,8-dimethylnaphthalen-2-yl)-(2,4-dimethylphenyl)diazene is sourced from PubChem (CID 20681158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).