About 1-(2-methoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde
1-(2-methoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde (PubChem CID 2068116) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde |
| PubChem CID | 2068116 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 1-(2-methoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde |
| SMILES | COCCn1c(C)cc(C=O)c1C |
| InChI | InChI=1S/C10H15NO2/c1-8-6-10(7-12)9(2)11(8)4-5-13-3/h6-7H,4-5H2,1-3H3 |
| InChIKey | PLAMSNVDPRMJRI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde?
The IUPAC name of 1-(2-methoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde (CID 2068116) is 1-(2-methoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde.
What is the SMILES notation for 1-(2-methoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde?
The canonical SMILES for 1-(2-methoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde is COCCn1c(C)cc(C=O)c1C.
What is the InChIKey of 1-(2-methoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde?
The InChIKey is PLAMSNVDPRMJRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-8-6-10(7-12)9(2)11(8)4-5-13-3/h6-7H,4-5H2,1-3H3.
What are the key properties of 1-(2-methoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde?
1-(2-methoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde has a molecular weight of 181.23 g/mol, XLogP of 1.56, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-2,5-dimethylpyrrole-3-carbaldehyde is sourced from PubChem (CID 2068116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).