About (2S)-2,6-diamino-N-methyl-4-(1-methylimidazol-2-yl)sulfonylhexanamide
(2S)-2,6-diamino-N-methyl-4-(1-methylimidazol-2-yl)sulfonylhexanamide (PubChem CID 20681216) has the molecular formula C11H21N5O3S
and a molecular weight of 303.39 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-methyl-4-(1-methylimidazol-2-yl)sulfonylhexanamide.
Molecular Properties
| Compound Name | (2S)-2,6-diamino-N-methyl-4-(1-methylimidazol-2-yl)sulfonylhexanamide |
| PubChem CID | 20681216 |
| Molecular Formula | C11H21N5O3S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (2S)-2,6-diamino-N-methyl-4-(1-methylimidazol-2-yl)sulfonylhexanamide |
| SMILES | CNC(=O)[C@@H](N)CC(CCN)S(=O)(=O)c1nccn1C |
| InChI | InChI=1S/C11H21N5O3S/c1-14-10(17)9(13)7-8(3-4-12)20(18,19)11-15-5-6-16(11)2/h5-6,8-9H,3-4,7,12-13H2,1-2H3,(H,14,17)/t8?,9-/m0/s1 |
| InChIKey | USTWEOALVLRHCJ-GKAPJAKFSA-N |
| XLogP | -1.63 |
| TPSA | 133.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2S)-2,6-diamino-N-methyl-4-(1-methylimidazol-2-yl)sulfonylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,6-diamino-N-methyl-4-(1-methylimidazol-2-yl)sulfonylhexanamide?
The IUPAC name of (2S)-2,6-diamino-N-methyl-4-(1-methylimidazol-2-yl)sulfonylhexanamide (CID 20681216) is (2S)-2,6-diamino-N-methyl-4-(1-methylimidazol-2-yl)sulfonylhexanamide.
What is the SMILES notation for (2S)-2,6-diamino-N-methyl-4-(1-methylimidazol-2-yl)sulfonylhexanamide?
The canonical SMILES for (2S)-2,6-diamino-N-methyl-4-(1-methylimidazol-2-yl)sulfonylhexanamide is CNC(=O)[C@@H](N)CC(CCN)S(=O)(=O)c1nccn1C.
What is the InChIKey of (2S)-2,6-diamino-N-methyl-4-(1-methylimidazol-2-yl)sulfonylhexanamide?
The InChIKey is USTWEOALVLRHCJ-GKAPJAKFSA-N. The full InChI is InChI=1S/C11H21N5O3S/c1-14-10(17)9(13)7-8(3-4-12)20(18,19)11-15-5-6-16(11)2/h5-6,8-9H,3-4,7,12-13H2,1-2H3,(H,14,17)/t8?,9-/m0/s1.
What are the key properties of (2S)-2,6-diamino-N-methyl-4-(1-methylimidazol-2-yl)sulfonylhexanamide?
(2S)-2,6-diamino-N-methyl-4-(1-methylimidazol-2-yl)sulfonylhexanamide has a molecular weight of 303.39 g/mol, XLogP of -1.63, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,6-diamino-N-methyl-4-(1-methylimidazol-2-yl)sulfonylhexanamide is sourced from PubChem (CID 20681216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).