C20H20N6O2 — CID 2068150
3-[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]benzoic acid (PubChem CID 2068150) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 3-[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]benzoic acid.
| Compound Name | 3-[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 2068150 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 3-[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2nc(Nc3ccccc3)nc(N3CCCC3)n2)c1 |
| InChI | InChI=1S/C20H20N6O2/c27-17(28)14-7-6-10-16(13-14)22-19-23-18(21-15-8-2-1-3-9-15)24-20(25-19)26-11-4-5-12-26/h1-3,6-10,13H,4-5,11-12H2,(H,27,28)(H2,21,22,23,24,25) |
| InChIKey | JMXVCIRSULFZLE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |