C12H36O10Si8 — CID 20681868
1,3,5,5,7,7,9,11,13,13,15,15-dodecamethyl-2,4,6,8,10,12,14,16,17,18-decaoxa-1,3,5,7,9,11,13,15-octasilatricyclo[9.5.1.13,9]octadecane (PubChem CID 20681868) has the molecular formula C12H36O10Si8 and a molecular weight of 565.10 g/mol. Its IUPAC name is 1,3,5,5,7,7,9,11,13,13,15,15-dodecamethyl-2,4,6,8,10,12,14,16,17,18-decaoxa-1,3,5,7,9,11,13,15-octasilatricyclo[9.5.1.13,9]octadecane.
| Compound Name | 1,3,5,5,7,7,9,11,13,13,15,15-dodecamethyl-2,4,6,8,10,12,14,16,17,18-decaoxa-1,3,5,7,9,11,13,15-octasilatricyclo[9.5.1.13,9]octadecane |
|---|---|
| PubChem CID | 20681868 |
| Molecular Formula | C12H36O10Si8 |
| Molecular Weight | 565.10 g/mol |
| Exact Mass | 564.05 |
| IUPAC Name | 1,3,5,5,7,7,9,11,13,13,15,15-dodecamethyl-2,4,6,8,10,12,14,16,17,18-decaoxa-1,3,5,7,9,11,13,15-octasilatricyclo[9.5.1.13,9]octadecane |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si]2(C)O[Si](C)(O1)O[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(O1)O2 |
| InChI | InChI=1S/C12H36O10Si8/c1-23(2)13-24(3,4)16-28(10)19-27(9,15-23)21-29(11)17-25(5,6)14-26(7,8)18-30(12,20-29)22-28/h1-12H3 |
| InChIKey | JHGDGJKVMBYLKE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.10 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|