C35H58O2 — CID 20681934
(1,2,3,3,4,5,5,6,6,7,7-undecamethyl-2-bicyclo[2.2.1]heptanyl) 4,5,9,10-tetramethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 20681934) has the molecular formula C35H58O2 and a molecular weight of 510.85 g/mol. Its IUPAC name is (1,2,3,3,4,5,5,6,6,7,7-undecamethyl-2-bicyclo[2.2.1]heptanyl) 4,5,9,10-tetramethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | (1,2,3,3,4,5,5,6,6,7,7-undecamethyl-2-bicyclo[2.2.1]heptanyl) 4,5,9,10-tetramethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 20681934 |
| Molecular Formula | C35H58O2 |
| Molecular Weight | 510.85 g/mol |
| Exact Mass | 510.44 |
| IUPAC Name | (1,2,3,3,4,5,5,6,6,7,7-undecamethyl-2-bicyclo[2.2.1]heptanyl) 4,5,9,10-tetramethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC1C(C)C2CC1C1C3CC(C21)C(C)(C(=O)OC1(C)C(C)(C)C2(C)C(C)(C)C(C)(C)C1(C)C2(C)C)C3C |
| InChI | InChI=1S/C35H58O2/c1-18-19(2)22-16-21(18)25-23-17-24(26(22)25)32(12,20(23)3)27(36)37-35(15)31(10,11)33(13)28(4,5)29(6,7)34(35,14)30(33,8)9/h18-26H,16-17H2,1-15H3 |
| InChIKey | KFINTUCANUQBDY-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.85 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|