C27H30Cl2N4O3 — CID 20682000
[6-isocyano-2-(2-methyl-1-oxopropan-2-yl)-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,6-dichlorobenzoate (PubChem CID 20682000) has the molecular formula C27H30Cl2N4O3 and a molecular weight of 529.47 g/mol. Its IUPAC name is [6-isocyano-2-(2-methyl-1-oxopropan-2-yl)-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,6-dichlorobenzoate.
| Compound Name | [6-isocyano-2-(2-methyl-1-oxopropan-2-yl)-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 20682000 |
| Molecular Formula | C27H30Cl2N4O3 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | [6-isocyano-2-(2-methyl-1-oxopropan-2-yl)-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,6-dichlorobenzoate |
| SMILES | [C-]#[N+]c1c(CC2C(C)CC(C)CC2C)c2nc(C(C)(C)C=O)[nH]n2c1OC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C27H30Cl2N4O3/c1-14-10-15(2)17(16(3)11-14)12-18-22(30-6)24(33-23(18)31-26(32-33)27(4,5)13-34)36-25(35)21-19(28)8-7-9-20(21)29/h7-9,13-17H,10-12H2,1-5H3,(H,31,32) |
| InChIKey | KOHHADVMUBHXIV-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|