C37H45N5O4 — CID 20682002
[2-[3-[(2,5-dimethylphenyl)methyl]-4-methoxyphenyl]-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate (PubChem CID 20682002) has the molecular formula C37H45N5O4 and a molecular weight of 623.80 g/mol. Its IUPAC name is [2-[3-[(2,5-dimethylphenyl)methyl]-4-methoxyphenyl]-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate.
| Compound Name | [2-[3-[(2,5-dimethylphenyl)methyl]-4-methoxyphenyl]-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 20682002 |
| Molecular Formula | C37H45N5O4 |
| Molecular Weight | 623.80 g/mol |
| Exact Mass | 623.35 |
| IUPAC Name | [2-[3-[(2,5-dimethylphenyl)methyl]-4-methoxyphenyl]-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate |
| SMILES | [C-]#[N+]c1c(CC2C(C)CC(C)CC2C)c2nc(-c3ccc(OC)c(Cc4cc(C)ccc4C)c3)[nH]n2c1OC(=O)N1CCOCC1 |
| InChI | InChI=1S/C37H45N5O4/c1-22-8-9-24(3)28(18-22)20-29-19-27(10-11-32(29)44-7)34-39-35-31(21-30-25(4)16-23(2)17-26(30)5)33(38-6)36(42(35)40-34)46-37(43)41-12-14-45-15-13-41/h8-11,18-19,23,25-26,30H,12-17,20-21H2,1-5,7H3,(H,39,40) |
| InChIKey | ONUFFHGOAXNBDI-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.80 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|