C23H32ClN5O2 — CID 20682037
N-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)ethyl]-2-(2,4-dimethylphenoxy)octanamide (PubChem CID 20682037) has the molecular formula C23H32ClN5O2 and a molecular weight of 446.00 g/mol. Its IUPAC name is N-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)ethyl]-2-(2,4-dimethylphenoxy)octanamide.
| Compound Name | N-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)ethyl]-2-(2,4-dimethylphenoxy)octanamide |
|---|---|
| PubChem CID | 20682037 |
| Molecular Formula | C23H32ClN5O2 |
| Molecular Weight | 446.00 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | N-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)ethyl]-2-(2,4-dimethylphenoxy)octanamide |
| SMILES | CCCCCCC(Oc1ccc(C)cc1C)C(=O)NCCc1nc2c(Cl)c(C)[nH]n2n1 |
| InChI | InChI=1S/C23H32ClN5O2/c1-5-6-7-8-9-19(31-18-11-10-15(2)14-16(18)3)23(30)25-13-12-20-26-22-21(24)17(4)27-29(22)28-20/h10-11,14,19,27H,5-9,12-13H2,1-4H3,(H,25,30) |
| InChIKey | QMMIHGGTOVZHBN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.00 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|