C19H20FN5O — CID 20682336
2-(5-fluoropyrimidin-2-yl)-7-[(3-isocyanophenyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 20682336) has the molecular formula C19H20FN5O and a molecular weight of 353.40 g/mol. Its IUPAC name is 2-(5-fluoropyrimidin-2-yl)-7-[(3-isocyanophenyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-(5-fluoropyrimidin-2-yl)-7-[(3-isocyanophenyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 20682336 |
| Molecular Formula | C19H20FN5O |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2-(5-fluoropyrimidin-2-yl)-7-[(3-isocyanophenyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | [C-]#[N+]c1cccc(COC2CC3CN(c4ncc(F)cn4)CCN3C2)c1 |
| InChI | InChI=1S/C19H20FN5O/c1-21-16-4-2-3-14(7-16)13-26-18-8-17-11-25(6-5-24(17)12-18)19-22-9-15(20)10-23-19/h2-4,7,9-10,17-18H,5-6,8,11-13H2 |
| InChIKey | RIQWWIXZQXCSAD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 45.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|