C13H19FN4O — CID 20682338
[2-(5-fluoropyrimidin-2-yl)-7-methyl-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]methanol (PubChem CID 20682338) has the molecular formula C13H19FN4O and a molecular weight of 266.32 g/mol. Its IUPAC name is [2-(5-fluoropyrimidin-2-yl)-7-methyl-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]methanol.
| Compound Name | [2-(5-fluoropyrimidin-2-yl)-7-methyl-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]methanol |
|---|---|
| PubChem CID | 20682338 |
| Molecular Formula | C13H19FN4O |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | [2-(5-fluoropyrimidin-2-yl)-7-methyl-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]methanol |
| SMILES | CC1(CO)CC2CN(c3ncc(F)cn3)CCN2C1 |
| InChI | InChI=1S/C13H19FN4O/c1-13(9-19)4-11-7-17(2-3-18(11)8-13)12-15-5-10(14)6-16-12/h5-6,11,19H,2-4,7-9H2,1H3 |
| InChIKey | CBQJBMHQOCXIOL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |