About 2,5-bis(ethenyl)-3,4-bis(methoxymethyl)oxolane
2,5-bis(ethenyl)-3,4-bis(methoxymethyl)oxolane (PubChem CID 20682585) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 2,5-bis(ethenyl)-3,4-bis(methoxymethyl)oxolane.
Molecular Properties
| Compound Name | 2,5-bis(ethenyl)-3,4-bis(methoxymethyl)oxolane |
| PubChem CID | 20682585 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2,5-bis(ethenyl)-3,4-bis(methoxymethyl)oxolane |
| SMILES | C=CC1OC(C=C)C(COC)C1COC |
| InChI | InChI=1S/C12H20O3/c1-5-11-9(7-13-3)10(8-14-4)12(6-2)15-11/h5-6,9-12H,1-2,7-8H2,3-4H3 |
| InChIKey | ZTLLDUIXRIBVOW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(ethenyl)-3,4-bis(methoxymethyl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(ethenyl)-3,4-bis(methoxymethyl)oxolane?
The IUPAC name of 2,5-bis(ethenyl)-3,4-bis(methoxymethyl)oxolane (CID 20682585) is 2,5-bis(ethenyl)-3,4-bis(methoxymethyl)oxolane.
What is the SMILES notation for 2,5-bis(ethenyl)-3,4-bis(methoxymethyl)oxolane?
The canonical SMILES for 2,5-bis(ethenyl)-3,4-bis(methoxymethyl)oxolane is C=CC1OC(C=C)C(COC)C1COC.
What is the InChIKey of 2,5-bis(ethenyl)-3,4-bis(methoxymethyl)oxolane?
The InChIKey is ZTLLDUIXRIBVOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-5-11-9(7-13-3)10(8-14-4)12(6-2)15-11/h5-6,9-12H,1-2,7-8H2,3-4H3.
What are the key properties of 2,5-bis(ethenyl)-3,4-bis(methoxymethyl)oxolane?
2,5-bis(ethenyl)-3,4-bis(methoxymethyl)oxolane has a molecular weight of 212.29 g/mol, XLogP of 1.65, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(ethenyl)-3,4-bis(methoxymethyl)oxolane is sourced from PubChem (CID 20682585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).