C17H22O2 — CID 20682947
3,4,5,6,8-pentamethyl-7-propan-2-ylchromen-2-one (PubChem CID 20682947) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3,4,5,6,8-pentamethyl-7-propan-2-ylchromen-2-one.
| Compound Name | 3,4,5,6,8-pentamethyl-7-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 20682947 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 3,4,5,6,8-pentamethyl-7-propan-2-ylchromen-2-one |
| SMILES | Cc1c(C(C)C)c(C)c2oc(=O)c(C)c(C)c2c1C |
| InChI | InChI=1S/C17H22O2/c1-8(2)14-9(3)10(4)15-11(5)12(6)17(18)19-16(15)13(14)7/h8H,1-7H3 |
| InChIKey | JTBHYBQGFHOANM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|