C22H29NO2 — CID 20682970
5,6,8,10,10,16,16-heptamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 20682970) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 5,6,8,10,10,16,16-heptamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 5,6,8,10,10,16,16-heptamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 20682970 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 5,6,8,10,10,16,16-heptamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | Cc1c(C)c2c(C)c3c4c(c2oc1=O)C(C)(C)CCN4CCC3(C)C |
| InChI | InChI=1S/C22H29NO2/c1-12-13(2)20(24)25-19-15(12)14(3)16-18-17(19)22(6,7)9-11-23(18)10-8-21(16,4)5/h8-11H2,1-7H3 |
| InChIKey | NNOQEBVXAMACIK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|